1-(3-HYDROXYPHENYL)-2-THIOUREA structure
|
Common Name | 1-(3-HYDROXYPHENYL)-2-THIOUREA | ||
|---|---|---|---|---|
| CAS Number | 15896-78-3 | Molecular Weight | 225.19800 | |
| Density | 1.378g/cm3 | Boiling Point | 367.3ºC at 760mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.2ºC | |
| Name | 4-methoxy-6-(2-nitroethyl)-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 367.3ºC at 760mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 177.2ºC |
| Exact Mass | 225.06400 |
| PSA | 73.51000 |
| LogP | 1.76630 |
| Vapour Pressure | 2.91E-05mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | CQLKFXWLIUUMNC-UHFFFAOYSA-N |
| SMILES | COc1cc(CC[N+](=O)[O-])cc2c1OCO2 |
| HS Code | 2932999099 |
|---|
|
~85%
1-(3-HYDROXYPHE... CAS#:15896-78-3 |
| Literature: Barnes, David M.; Wittenberger, Steven J.; Zhang, Ji; Ji, Jianguo; Fickes, Michael G.; Fitzgerald, Michael A.; King, Steven A.; Morton, Howard E.; Plagge, Frederick A.; Preskill, Margo; Wagaw, Seble H. Journal of the American Chemical Society, 2002 , vol. 124, # 44 p. 13097 - 13105 |
|
~%
1-(3-HYDROXYPHE... CAS#:15896-78-3 |
| Literature: Abbott Laboratories Patent: US6162927 A1, 2000 ; US 6162927 A |
|
~%
1-(3-HYDROXYPHE... CAS#:15896-78-3 |
| Literature: Spaeth; Gangl Monatshefte fuer Chemie, 1923 , vol. 44, p. 110 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Methoxy-6-(2-nitro-vinyl)-benzo[1,3]dioxol |
| 4-methoxy-6-(2-nitrovinyl)-1,3-benzodioxole |
| 4-methoxy-6-(2-nitro-vinyl)-benzo[1,3]dioxole |
| Styrene,3-methoxy-4,5-(methylenedioxy)-b-nitro-(8CI) |
| 1,3-Benzodioxole,4-methoxy-6-(2-nitroethenyl) |