1-(3-Hydroxyphenyl)-2-[methyl(phenylmethyl)amino]-ethanone hydrochloride structure
|
Common Name | 1-(3-Hydroxyphenyl)-2-[methyl(phenylmethyl)amino]-ethanone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 71786-67-9 | Molecular Weight | 291.773 | |
| Density | N/A | Boiling Point | 420.6ºC at 760 mmHg | |
| Molecular Formula | C16H18ClNO2 | Melting Point | 214-216ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 208.2ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2-[benzyl(methyl)amino]-1-(3-hydroxyphenyl)ethanone,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 420.6ºC at 760 mmHg |
|---|---|
| Melting Point | 214-216ºC (dec.) |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.773 |
| Flash Point | 208.2ºC |
| Exact Mass | 291.102600 |
| PSA | 40.54000 |
| LogP | 3.50890 |
| InChIKey | QGHUDAOMXLLADV-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)c1cccc(O)c1)Cc1ccccc1.Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318-H412 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 + P310 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2922509090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Benzyl-2-(3-hydroxyphenyl)-N-methyl-2-oxoethanaminium chloride |
| 2-(benzyl-methyl-amino)-1-(3-hydroxy-phenyl)-ethanone,hydrochloride |
| EINECS 276-017-4 |
| N-benzyl-N-methyl-2-amino-m-hydroxyacetophenone hydrochloride |
| Ethanone, 1-(3-hydroxyphenyl)-2-[methyl(phenylmethyl)amino]-, hydrochloride (1:1) |
| 2-(Benzyl-methyl-amino)-1-(3-hydroxy-phenyl)-aethanon,Hydrochlorid |
| rac Benzyl Phenylephrone Hydrochloride |
| 1-(Benzylmethylamino)-2-(3-hydroxyphenyl)-2-oxoethane hydrochloride |
| Ethanone, 1-(3-hydroxyphenyl)-2-(methyl(phenylmethyl)amino)-, hydrochloride |
| 2-[Benzyl(methyl)amino]-1-(3-hydroxyphenyl)ethanone hydrochloride (1:1) |
| Benzyl(3-hydroxyphenacyl)methylammonium chloride |