diethyl mucate structure
|
Common Name | diethyl mucate | ||
|---|---|---|---|---|
| CAS Number | 15909-67-8 | Molecular Weight | 266.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl mucate |
|---|
| Molecular Formula | C10H18O8 |
|---|---|
| Molecular Weight | 266.24500 |
| Exact Mass | 266.10000 |
| PSA | 133.52000 |
| InChIKey | VYFOOXBIRRKSIH-SOSBWXJGSA-N |
| SMILES | CCOC(=O)C(O)C(O)C(O)C(O)C(=O)OCC |
| HS Code | 2918199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |