1H-Isoindole-1,3(2H)-dione,2-[1,1'-biphenyl]-4-yl- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-[1,1'-biphenyl]-4-yl- | ||
|---|---|---|---|---|
| CAS Number | 1592-49-0 | Molecular Weight | 299.32300 | |
| Density | 1.289g/cm3 | Boiling Point | 507.2ºC at 760 mmHg | |
| Molecular Formula | C20H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.3ºC | |
| Name | 2-(4-phenylphenyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 507.2ºC at 760 mmHg |
| Molecular Formula | C20H13NO2 |
| Molecular Weight | 299.32300 |
| Flash Point | 238.3ºC |
| Exact Mass | 299.09500 |
| PSA | 37.38000 |
| LogP | 4.21920 |
| Vapour Pressure | 2.07E-10mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | NJTCXXFLSXRCRT-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(-c2ccccc2)cc1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Phthalimide,N-4-biphenylyl |
| 1H-Isoindole-1,3(2H)-dione,2-[1,1'-biphenyl]-4-yl |
| N-p-Biphenyl-phthalimid |
| N-p-Biphenylylphthalimide |
| 4-Phthalimido-biphenyl |
| N-(4-Biphenylyl)phthalic acid imide |
| N-biphenyl-4-yl-phthalimide |