1,5-Bis[(2-hydroxyethyl)amino]anthraquinone structure
|
Common Name | 1,5-Bis[(2-hydroxyethyl)amino]anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 15939-84-1 | Molecular Weight | 326.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-bis(2-hydroxyethylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18N2O4 |
|---|---|
| Molecular Weight | 326.34700 |
| Exact Mass | 326.12700 |
| PSA | 98.66000 |
| LogP | 1.41640 |
| InChIKey | NHCOLOILTUTOLA-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc(NCCO)c2C(=O)c2cccc(NCCO)c21 |
| HS Code | 2922509090 |
|---|
|
~80%
1,5-Bis[(2-hydr... CAS#:15939-84-1 |
| Literature: Huang, Hsu-Shan; Chiu, Hui-Fen; Yeh, Pen-Fong; Yuan, Chun-Lung Helvetica Chimica Acta, 2004 , vol. 87, # 4 p. 999 - 1006 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,5-bis(2-hydroxy-ethylamino)anthraquinone |
| 1,5-bis[(2-hydroxyethyl)amino]-9,10-anthraquinone |
| 9,10-Anthracenedione,1,5-bis[(2-hydroxyethyl)amino] |
| 1,5-Bis-(2-hydroxy-aethylamino)-anthrachinon |
| 1,5-bis(ethanolamino)anthraquinone |