4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane
Modify Date: 2025-09-09 20:13:58
![4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane Structure](https://www.chemsrc.com/extcaspic/043/1593974-03-8.png)
4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane structure
|
Common Name | 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane | ||
|---|---|---|---|---|
| CAS Number | 1593974-03-8 | Molecular Weight | 297.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13BrClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H13BrClF3O |
|---|---|
| Molecular Weight | 297.54 |
| InChIKey | NIUKTBXYXPBLIG-UHFFFAOYSA-N |
| SMILES | CC(CCl)(CBr)OCCCC(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane? |
| A: SMILES notation of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane is CC(CCl)(CBr)OCCCC(F)(F)F. |
| Q: What is the CAS number of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane? |
| A: CAS number of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane is 1593974-03-8. |
| Q: What is the molecular weight of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane? |
| A: Molecular weight of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane is 297.54. |
| Q: What is the molecular formula of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane? |
| A: Molecular formula of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane is C8H13BrClF3O. |
| Q: What is the English name of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane? |
| A: The English name of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane is 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane. |
| Q: What is the Chinese name of 1593974-03-8? |
| A: Chinese name of 1593974-03-8 is 1593974-03-8. |
| Q: What is the InChIKey of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane? |
| A: InChIKey of 4-[(1-Bromo-3-chloro-2-methylpropan-2-yl)oxy]-1,1,1-trifluorobutane is NIUKTBXYXPBLIG-UHFFFAOYSA-N. |