1-cyanobicyclo[2.2.2]octane-4-carboxylic acid structure
|
Common Name | 1-cyanobicyclo[2.2.2]octane-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 15941-09-0 | Molecular Weight | 179.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-cyanobicyclo[2.2.2]octane-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO2 |
|---|---|
| Molecular Weight | 179.21600 |
| Exact Mass | 179.09500 |
| PSA | 61.09000 |
| LogP | 1.93518 |
| InChIKey | ONXKUOTWYIGFMY-UHFFFAOYSA-N |
| SMILES | N#CC12CCC(C(=O)O)(CC1)CC2 |
|
~%
1-cyanobicyclo[... CAS#:15941-09-0 |
| Literature: Roberts et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 637,639 |
|
~%
1-cyanobicyclo[... CAS#:15941-09-0 |
| Literature: Roberts et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 637,639 |
| 4-cyanobicyclo<2.2.2>octane-1-carboxylic acid |
| 4-Cyan-bicyclo<2.2.2>octan-1-carbonsaeure |
| Bicyclo[2.2.2]octane-1-carboxylic acid,4-cyano |
| 4-Cyano-<2.2.2>bicyclooctan-1-carbonsaeure |