Diethyl bicyclo[2.2.2]octane-1,4-dicarboxylate structure
|
Common Name | Diethyl bicyclo[2.2.2]octane-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1659-75-2 | Molecular Weight | 254.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Diethyl bicyclo[2.2.2]octane-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22O4 |
|---|---|
| Molecular Weight | 254.32200 |
| Exact Mass | 254.15200 |
| PSA | 52.60000 |
| LogP | 2.45320 |
| InChIKey | WHIYNXJTNHXZES-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C12CCC(C(=O)OCC)(CC1)CC2 |
| HS Code | 2917209090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Diethyl Bicyclo<2.2.2>octane-1,4-dicarboxylate |
| 1,4-bisethoxycarbonylbicyclo[2.2.2]octane |
| Bicyclo[2.2.2]octan-1,4-dicarbonsaeure-diaethylester |
| diethyl 1,4-bicyclo<2.2.2>octanecarboxylate |
| Bicyclo[2.2.2]octane-1,4-dicarboxylic acid,diethyl ester |
| Bicyclo<2.2.2.>octan-1,4-dicarbonsauere-ethylester |