1,3-Dichloro-1,3-dimethyl-1,3-divinyldisiloxane structure
|
Common Name | 1,3-Dichloro-1,3-dimethyl-1,3-divinyldisiloxane | ||
|---|---|---|---|---|
| CAS Number | 15948-19-3 | Molecular Weight | 227.236 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 176.4±9.0 °C at 760 mmHg | |
| Molecular Formula | C6H12Cl2OSi2 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 52.0±10.8 °C | |
| Name | chloro-(chloro-ethenyl-methylsilyl)oxy-ethenyl-methylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 176.4±9.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C6H12Cl2OSi2 |
| Molecular Weight | 227.236 |
| Flash Point | 52.0±10.8 °C |
| Exact Mass | 225.980377 |
| PSA | 9.23000 |
| LogP | 6.17 |
| Vapour Pressure | 1.5±0.3 mmHg at 25°C |
| Index of Refraction | 1.445 |
| InChIKey | QNXUEHHVVZBQHD-UHFFFAOYSA-N |
| SMILES | C=C[Si](C)(Cl)O[Si](C)(Cl)C=C |
| Risk Phrases | 10-34 |
|---|---|
| Safety Phrases | 16-26-36/37/39 |
| RIDADR | UN 2986 |
| HS Code | 2934999090 |
|
~%
1,3-Dichloro-1,... CAS#:15948-19-3 |
| Literature: Journal of the Chemical Society [Section] B: Physical Organic, , p. 488 - 492 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Disiloxane, 1,3-dichloro-1,3-diethenyl-1,3-dimethyl- |
| 1,3-DIVINYL-1,3-DIMETHYL-1,3-DICHLORODISILOXANE |
| Disiloxane,1,3-dichloro-1,3-diethenyl-1,3-dimethyl |
| 1,3-Dichlor-1,3-dimethyl-1,3-divinyldisiloxan |
| 1,3-Dichloro-1,3-dimethyl-1,3-divinyldisiloxane |
| EINECS 240-081-1 |