2-Chloro-6-methyl-3,5-dinitropyridine structure
|
Common Name | 2-Chloro-6-methyl-3,5-dinitropyridine | ||
|---|---|---|---|---|
| CAS Number | 15951-30-1 | Molecular Weight | 217.56700 | |
| Density | 1.616g/cm3 | Boiling Point | 331.4ºC at 760 mmHg | |
| Molecular Formula | C6H4ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.2ºC | |
| Name | 2-Chloro-6-methyl-3,5-dinitropyridine |
|---|
| Density | 1.616g/cm3 |
|---|---|
| Boiling Point | 331.4ºC at 760 mmHg |
| Molecular Formula | C6H4ClN3O4 |
| Molecular Weight | 217.56700 |
| Flash Point | 154.2ºC |
| Exact Mass | 216.98900 |
| PSA | 104.53000 |
| LogP | 2.90620 |
| Vapour Pressure | 0.000301mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | SMTSVFRZTHCNRS-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |