3-Bromo-6-chloro-2-methyl-5-nitropyridine structure
|
Common Name | 3-Bromo-6-chloro-2-methyl-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 186413-75-2 | Molecular Weight | 251.465 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 306.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H4BrClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1±26.5 °C | |
| Name | 5-bromo-2-chloro-6-methyl-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 306.3±37.0 °C at 760 mmHg |
| Molecular Formula | C6H4BrClN2O2 |
| Molecular Weight | 251.465 |
| Flash Point | 139.1±26.5 °C |
| Exact Mass | 249.914459 |
| PSA | 58.71000 |
| LogP | 2.26 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | PVECCSKVOZZRPC-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)c([N+](=O)[O-])cc1Br |
| Storage condition | 2-8°C |
|
~72%
3-Bromo-6-chlor... CAS#:186413-75-2 |
| Literature: Pomel; Rovera; Godard; Marsais; Queguiner Journal of Heterocyclic Chemistry, 1996 , vol. 33, # 6 p. 1995 - 2005 |
|
~%
3-Bromo-6-chlor... CAS#:186413-75-2 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 33, # 6 p. 1995 - 2005 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CL0254 |
| 2-Chloro-3-nitro-5-bromo-6-picoline |
| 5-Bromo-2-chloro-3-nitro-6-picoline |
| 3-Bromo-6-chloro-2-methyl-5-nitropyridine |