1,3-Dichloro-2,4-difluoro-5-nitrobenzene structure
|
Common Name | 1,3-Dichloro-2,4-difluoro-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 15952-70-2 | Molecular Weight | 227.980 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 268.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C6HCl2F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.9±25.9 °C | |
| Name | 1,3-dichloro-2,4-difluoro-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 268.0±35.0 °C at 760 mmHg |
| Molecular Formula | C6HCl2F2NO2 |
| Molecular Weight | 227.980 |
| Flash Point | 115.9±25.9 °C |
| Exact Mass | 226.935242 |
| PSA | 45.82000 |
| LogP | 3.25 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | OWALCRQILZGQDH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(F)c(Cl)c1F |
| Hazard Codes | Xi:Irritant; |
|---|---|
| HS Code | 2904909090 |
|
~33%
1,3-Dichloro-2,... CAS#:15952-70-2 |
| Literature: Bayer Aktiengesellschaft Patent: US4868347 A1, 1989 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1,3-dichloro-2,4-difluoro-5-nitro- |
| 3,5-DICHLORO-2,4-DIFLUORONITROBENZENE |
| 3,5-Dichlor-2,4-difluornitrobenzol |
| 1,3-Dichloro-2,4-difluoro-5-nitrobenzene |
| 2,4-Difluoro-3,5-dichloronitrobenzene |
| MFCD03094441 |