6-Benzyl-3-Methyl-2-thioxo-2,3,5,6,7,8-hexahydropyrido[4,3-d]pyrimidin-4(1H)-one structure
|
Common Name | 6-Benzyl-3-Methyl-2-thioxo-2,3,5,6,7,8-hexahydropyrido[4,3-d]pyrimidin-4(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 159660-86-3 | Molecular Weight | 287.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Benzyl-3-methyl-2-thioxo-2,3,5,6,7,8-hexahydropyrido[4,3-d]pyri midin-4(1H)-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17N3OS |
|---|---|
| Molecular Weight | 287.38000 |
| Exact Mass | 287.10900 |
| PSA | 76.93000 |
| LogP | 1.56520 |
| InChIKey | ILLBLVIXGWVCNC-UHFFFAOYSA-N |
| SMILES | Cn1c(=S)[nH]c2c(c1=O)CN(Cc1ccccc1)CC2 |
| HS Code | 2933990090 |
|---|
|
~48%
6-Benzyl-3-Meth... CAS#:159660-86-3 |
| Literature: Furrer; Fehlhaber; Wagner Journal of Heterocyclic Chemistry, 1994 , vol. 31, # 6 p. 1569 - 1575 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-benzyl-3-isobutoxycyclohex-2-en-1-one |
| 6-Benzyl-3-methyl-2-thioxo-2,3,5,6,7,8-hexahydropyrido[4,3-d]pyrimidin-4(1H)-one |
| 6-benzyl-3-methyl-2-thioxo-2,3,5,6,7,8-hexahydro-1H-pyrido[4,3-d]pyrimidin-4-one |
| 6-benzyl-3-isobutoxy-cyclohex-2-enone |
| 2-Cyclohexen-1-one,3-(2-methylpropoxy)-6-(phenylmethyl) |