Methyl 4-amino-1-benzyl-1,2,5,6-tetrahydropyridine-3-carboxylate structure
|
Common Name | Methyl 4-amino-1-benzyl-1,2,5,6-tetrahydropyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 159660-85-2 | Molecular Weight | 246.30500 | |
| Density | 1.0836 (rough estimate) | Boiling Point | 389.2ºC at 760mmHg | |
| Molecular Formula | C14H18N2O2 | Melting Point | 87-89ºC | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | Methyl 4-amino-1-benzyl-1,2,5,6-tetrahydropyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0836 (rough estimate) |
|---|---|
| Boiling Point | 389.2ºC at 760mmHg |
| Melting Point | 87-89ºC |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.30500 |
| Flash Point | 189.2ºC |
| Exact Mass | 246.13700 |
| PSA | 55.56000 |
| LogP | 1.91630 |
| Appearance of Characters | Crystals or Crystalline Powder | Light orange |
| Vapour Pressure | 2.91E-06mmHg at 25°C |
| Index of Refraction | 1.5500 (estimate) |
| InChIKey | HLKWMBMESNOAMS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N)CCN(Cc2ccccc2)C1 |
| HS Code | 29333999 |
|---|
|
~%
Methyl 4-amino-... CAS#:159660-85-2 |
| Literature: US5556854 A1, ; |
| methyl 4-amino-1-benzyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| MFCD00216930 |