6,6-Bis(p-methoxyphenyl)fulvene structure
|
Common Name | 6,6-Bis(p-methoxyphenyl)fulvene | ||
|---|---|---|---|---|
| CAS Number | 15972-55-1 | Molecular Weight | 290.35600 | |
| Density | 1.127g/cm3 | Boiling Point | 477.9ºC at 760mmHg | |
| Molecular Formula | C20H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.5ºC | |
| Name | 1-[cyclopenta-2,4-dien-1-ylidene-(4-methoxyphenyl)methyl]-4-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 477.9ºC at 760mmHg |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.35600 |
| Flash Point | 193.5ºC |
| Exact Mass | 290.13100 |
| PSA | 18.46000 |
| LogP | 4.63170 |
| Vapour Pressure | 7.78E-09mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | ZTPIYEQWTZQQCA-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=C2C=CC=C2)c2ccc(OC)cc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~9%
6,6-Bis(p-metho... CAS#:15972-55-1 |
| Literature: Jeffery, John; Probitts, E. Jane; Mawby, Roger J. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1984 , p. 2423 - 2428 |
|
~%
6,6-Bis(p-metho... CAS#:15972-55-1 |
| Literature: Alper,H.; Paik,H.-N. Journal of the American Chemical Society, 1978 , vol. 100, # 2 p. 508 - 512 |
|
~34%
6,6-Bis(p-metho... CAS#:15972-55-1 |
| Literature: Okuma, Kentaro; Kojima, Kazuki; Kaneko, Isao; Ohta, Hiroshi Chemistry Letters, 1991 , # 6 p. 1053 - 1056 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| bis(p-methoxyphenyl)fulvene |
| 4,4'-(cyclopenta-2,4-dien-1-ylidenemethylene)bis(methoxybenzene) |
| 6,6-Bis(4-methoxyphenyl)fulven |
| 6,6-Dianisylfulven |
| 6,6-bis(4-methoxyphenyl)fulvene |
| Bis(methoxyphenyl)fulven |
| 4,4'-dimethoxydiphenylfulvene |
| 6,6-bis(p-methoxyphenyl)fulvene |