2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine
2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine structure
|
Common Name | 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 71103-75-8 | Molecular Weight | 368.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,4-Bis(4-methoxyphenyl)-6-phenylpyrimidine, Chinese name unknown, CAS number 71103-75-8, molecular formula C24H20N2O2, molecular weight 368.42800, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H20N2O2 |
|---|---|
| Molecular Weight | 368.42800 |
| Exact Mass | 368.15200 |
| PSA | 44.24000 |
| LogP | 5.49480 |
| InChIKey | BMFDSZYLYPVVNI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(OC)cc3)n2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~94%
2,4-bis(4-metho... CAS#:71103-75-8 |
| Literature: Adib, Mehdi; Mahmoodi, Niusha; Mahdavi, Mohammad; Bijanzadeh, Hamid Reza Tetrahedron Letters, 2006 , vol. 47, # 52 p. 9365 - 9368 |
|
~0%
2,4-bis(4-metho... CAS#:71103-75-8 |
| Literature: Weis, A. L.; Rosenbach, V. Tetrahedron Letters, 1981 , vol. 22, # 15 p. 1453 - 1454 |
|
~65%
2,4-bis(4-metho... CAS#:71103-75-8 |
| Literature: Wu, Ping; Cai, Xi-Mei; Wang, Qi-Fang; Yan, Chao-Guo Synthetic Communications, 2007 , vol. 37, # 2 p. 223 - 229 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-Bis-p-methoxyphenyl-4-phenylpyrimidin |
| Pyrimidine,2,4-bis(4-methoxyphenyl)-6-phenyl |
| 2,4-bis-(4-methoxy-phenyl)-6-phenyl-pyrimidine |
| 2,6-di(4-methoxyphenyl)-4-phenylpyrimidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine have? |
| A: English synonyms of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine: 2,6-Bis-p-methoxyphenyl-4-phenylpyrimidin, Pyrimidine,2,4-bis(4-methoxyphenyl)-6-phenyl, 2,4-bis-(4-methoxy-phenyl)-6-phenyl-pyrimidine, 2,6-di(4-methoxyphenyl)-4-phenylpyrimidine. |
| Q: What is the SMILES notation of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine? |
| A: SMILES notation of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine is COc1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(OC)cc3)n2)cc1. |
| Q: What is the InChIKey of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine? |
| A: InChIKey of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine is BMFDSZYLYPVVNI-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine? |
| A: Related upstream materials(CAS) of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine: 123-11-5;874-90-8;98-86-2;120-46-7;20517-71-9. |
| Q: What is the molecular formula of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine? |
| A: Molecular formula of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine is C24H20N2O2. |
| Q: What is the LogP of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine? |
| A: LogP of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine is 5.49480. |
| Q: What is the CAS number of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine? |
| A: CAS number of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine is 71103-75-8. |
| Q: What is the Chinese name of 71103-75-8? |
| A: Chinese name of 71103-75-8 is 71103-75-8. |
| Q: What is the molecular weight of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine? |
| A: Molecular weight of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine is 368.42800. |
| Q: What is the English name of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine? |
| A: The English name of 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine is 2,4-bis(4-methoxyphenyl)-6-phenylpyrimidine. |