3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide
3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide structure
|
Common Name | 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 159754-84-4 | Molecular Weight | 249.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10F3NO3 |
|---|---|
| Molecular Weight | 249.18700 |
| Exact Mass | 249.06100 |
| PSA | 73.05000 |
| LogP | 1.82620 |
| InChIKey | WLMLIEUAHQLTML-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1NC(=O)C(O)(O)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,3,3-trifluoro... CAS#:159754-84-4 |
| Literature: El Kaim, Laurent; Pinot-Perigord, Emmanuel Tetrahedron, 1998 , vol. 54, # 15 p. 3799 - 3806 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propanamide,3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl) |
| N-o-tolyl-3,3,3-trifluoro-2,2-dihydroxypropionamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide? |
| A: Polar surface area (PSA) of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide is 73.05000. |
| Q: What is the SMILES notation of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide? |
| A: SMILES notation of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide is Cc1ccccc1NC(=O)C(O)(O)C(F)(F)F. |
| Q: What is the CAS number of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide? |
| A: CAS number of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide is 159754-84-4. |
| Q: What is the English name of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide? |
| A: The English name of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide is 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide. |
| Q: What is the InChIKey of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide? |
| A: InChIKey of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide is WLMLIEUAHQLTML-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide? |
| A: Molecular formula of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide is C10H10F3NO3. |
| Q: What is the molecular weight of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide? |
| A: Molecular weight of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide is 249.18700. |
| Q: What is the Chinese name of 159754-84-4? |
| A: Chinese name of 159754-84-4 is 159754-84-4. |
| Q: What English synonyms does 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide have? |
| A: English synonyms of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide: Propanamide,3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl), N-o-tolyl-3,3,3-trifluoro-2,2-dihydroxypropionamide. |
| Q: What is the LogP of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide? |
| A: LogP of 3,3,3-trifluoro-2,2-dihydroxy-N-(2-methylphenyl)propanamide is 1.82620. |