tert-Butyl 4-(oxiran-2-ylmethyl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(oxiran-2-ylmethyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 159873-06-0 | Molecular Weight | 242.31500 | |
| Density | 1.134g/cm3 | Boiling Point | 324.3ºC at 760mmHg | |
| Molecular Formula | C12H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
| Name | tert-Butyl 4-(oxiran-2-ylmethyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 324.3ºC at 760mmHg |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.31500 |
| Flash Point | 149.9ºC |
| Exact Mass | 242.16300 |
| PSA | 45.31000 |
| LogP | 0.81370 |
| Vapour Pressure | 0.000249mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | XDRGUPXMFDJOFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC2CO2)CC1 |
|
~88%
tert-Butyl 4-(o... CAS#:159873-06-0 |
| Literature: Gyogyszerkutato Intezet KFT Patent: US5380724 A1, 1995 ; |
|
~84%
tert-Butyl 4-(o... CAS#:159873-06-0 |
| Literature: Bombrun, Agnes; Gerber, Patrick; Casi, Giulio; Terradillos, Olivier; Antonsson, Bruno; Halazy, Serge Journal of Medicinal Chemistry, 2003 , vol. 46, # 21 p. 4365 - 4368 |
|
~72%
tert-Butyl 4-(o... CAS#:159873-06-0 |
| Literature: Applied Research Systems ARS Holding N.V. Patent: EP1094063 A1, 2001 ; |
| tert-butyl 4-oxiranylmethylpiperazine-1-carboxylate |
| (S)-4-Oxiranylmethyl-piperazine-1-carboxylic acidtert-butyl ester |
| (+/-)-4-oxiranylmethylpiperazine-1-carboxylic acid tert-butyl ester |
| 1-(2,3-Epoxypropyl)-4-(tert-butoxycarbonyl)piperazine |