1-(4,5-Methylenedioxy-2-Nitrophenol)Ethan-2-OL structure
|
Common Name | 1-(4,5-Methylenedioxy-2-Nitrophenol)Ethan-2-OL | ||
|---|---|---|---|---|
| CAS Number | 159873-64-0 | Molecular Weight | 211.17100 | |
| Density | 1.5±0.1g/cm3 | Boiling Point | 393.3±42.0°C at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6±27.9°C | |
| Name | 1-(6-nitro-1,3-benzodioxol-5-yl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1g/cm3 |
|---|---|
| Boiling Point | 393.3±42.0°C at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17100 |
| Flash Point | 191.6±27.9°C |
| Exact Mass | 211.04800 |
| PSA | 84.51000 |
| LogP | 1.90000 |
| Index of Refraction | 1.614 |
| InChIKey | UHJMDARCOIYCHL-UHFFFAOYSA-N |
| SMILES | CC(O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| F9995-1220 |
| methylnitropiperonyl alcohol |
| 1-(4,5-Methylenedioxy-2-Nitrophenol)Ethan-2-OL |