N-Benzoxycarbonyl-5-(methylsulfonyloxy)-L-norvaline, tert-butyl ester structure
|
Common Name | N-Benzoxycarbonyl-5-(methylsulfonyloxy)-L-norvaline, tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 159877-09-5 | Molecular Weight | 401.47400 | |
| Density | 1.213 | Boiling Point | N/A | |
| Molecular Formula | C18H27NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl (2S)-5-methylsulfonyloxy-2-(phenylmethoxycarbonylamino)pentanoate |
|---|
| Density | 1.213 |
|---|---|
| Molecular Formula | C18H27NO7S |
| Molecular Weight | 401.47400 |
| Exact Mass | 401.15100 |
| PSA | 116.38000 |
| LogP | 3.85120 |
| Index of Refraction | 1.518 |
| InChIKey | RTLIQGGSCSOEPF-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)C(CCCOS(C)(=O)=O)NC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~96%
N-Benzoxycarbon... CAS#:159877-09-5 |
| Literature: Bavetsias, Vassilios; Bisset, Graham M. F.; Kimbell, Rosemary; Boyle, F. Thomas; Jackman, Ann L. Tetrahedron, 1997 , vol. 53, # 39 p. 13383 - 13396 |
|
~%
N-Benzoxycarbon... CAS#:159877-09-5 |
| Literature: Tetrahedron, , vol. 53, # 39 p. 13383 - 13396 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |