Z-Glu-OtBu
Z-Glu-OtBu structure
|
Common Name | Z-Glu-OtBu | ||
|---|---|---|---|---|
| CAS Number | 5891-45-2 | Molecular Weight | 337.368 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 522.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO6 | Melting Point | 83 °C | |
| MSDS | N/A | Flash Point | 269.9±30.1 °C | |
Use of Z-Glu-OtBuZ-Glu-OtBu is a glutamic acid derivative[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Z-Glu-OtBu is a glutamic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.6±50.0 °C at 760 mmHg |
| Melting Point | 83 °C |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.368 |
| Flash Point | 269.9±30.1 °C |
| Exact Mass | 337.152527 |
| PSA | 101.93000 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | VJECGKAFPHEJQS-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)C(CCC(=O)O)NC(=O)OCc1ccccc1 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 4 | |
CAS#:57732-63-5
CAS#:1155-62-0
CAS#:32159-21-0
CAS#:4124-76-9
CAS#:4652-65-7
CAS#:357958-50-0
CAS#:56-86-0
CAS#:1499-55-4
CAS#:23632-67-9
CAS#:45120-30-7
CAS#:159877-09-5
CAS#:124620-51-5
CAS#:16881-39-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (4S)-4-{[(Benzyloxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-5-tert-butoxy-5-oxopentanoic acid (non-preferred name) |
| N-[(Phenylmethoxy)carbonyl]-L-glutamic acid tert-butyl ester |
| Cbz-L-glutamic acid 1-tert-butyl ester |
| N2-(benzyloxycarbonyl)-L-glutamic acid 1-tert-butyl ester |
| (4S)-4-{[(Benzyloxy)carbonyl]amino}-5-tert-butoxy-5-oxopentanoic acid (non-preferred name) |
| (S)-2-(benzyloxycarbonylamino)pentanedioic acid tert-butyl ester |
| MFCD00077016 |
| L-Glutamic acid, N-[(phenylmethoxy)carbonyl]-, 1-(1,1-dimethylethyl) ester |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| z-glu-otbu |
| L-Glutamic acid, N-[(phenylmethoxy)carbonyl]-, 5-(1,1-dimethylethyl) ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: Molecular weight of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid is 337.368. |
| Q: What are the upstream materials of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: Related upstream materials(CAS) of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid: 57732-63-5;1155-62-0;32159-21-0;4124-76-9;4652-65-7;357958-50-0;56-86-0;1499-55-4;23632-67-9. |
| Q: What is the molecular formula of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: Molecular formula of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid is C17H23NO6. |
| Q: What is the English name of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: The English name of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid is 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid. |
| Q: What is the melting point of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: Melting point of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid is 83 °C. |
| Q: What are the uses of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: Main uses of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid: Z-Glu-OtBu is a glutamic acid derivative[1]. |
| Q: What are the downstream products of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: Related downstream products(CAS) of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid: 45120-30-7;159877-09-5;124620-51-5;16881-39-3. |
| Q: What is the InChIKey of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: InChIKey of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid is VJECGKAFPHEJQS-ZDUSSCGKSA-N. |
| Q: What is the SMILES notation of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: SMILES notation of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid is CC(C)(C)OC(=O)C(CCC(=O)O)NC(=O)OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid? |
| A: Polar surface area (PSA) of 5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid is 101.93000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |