({N-[(9H-Fluoren-9-ylmethoxy)carbonyl]glycyl}amino)methyl acetate structure
|
Common Name | ({N-[(9H-Fluoren-9-ylmethoxy)carbonyl]glycyl}amino)methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 1599440-06-8 | Molecular Weight | 368.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ({N-[(9H-Fluoren-9-ylmethoxy)carbonyl]glycyl}amino)methyl acetateFmoc-Gly-NH-CH2-acetyloxy is a cleavable linker that can be used to synthesize antiboy-drug Conjugates (ADCs). |
| Name | (2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acetamido)methyl acetate |
|---|
| Description | Fmoc-Gly-NH-CH2-acetyloxy is a cleavable linker that can be used to synthesize antiboy-drug Conjugates (ADCs). |
|---|---|
| Related Catalog |
| Molecular Formula | C20H20N2O5 |
|---|---|
| Molecular Weight | 368.38 |
| InChIKey | NKDSPEFADHLMHN-UHFFFAOYSA-N |
| SMILES | CC(=O)OCNC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |