Ethyl 4-(4-bromophenyl)-3-oxobutanoate structure
|
Common Name | Ethyl 4-(4-bromophenyl)-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 160010-18-4 | Molecular Weight | 285.13400 | |
| Density | 1.39g/cm3 | Boiling Point | 345.1ºC at 760 mmHg | |
| Molecular Formula | C12H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.5ºC | |
| Name | Ethyl 4-(4-bromophenyl)-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 345.1ºC at 760 mmHg |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.13400 |
| Flash Point | 162.5ºC |
| Exact Mass | 284.00500 |
| PSA | 43.37000 |
| LogP | 2.51390 |
| Vapour Pressure | 6.29E-05mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | BRYNITBKFYVFBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)Cc1ccc(Br)cc1 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 2-(4-bromophenylacetyl)acetate |