Ethenesulfonicacid, 2,2-diphenyl-, methyl ester structure
|
Common Name | Ethenesulfonicacid, 2,2-diphenyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 16003-64-8 | Molecular Weight | 274.33500 | |
| Density | 1.223g/cm3 | Boiling Point | 425.4ºC at 760mmHg | |
| Molecular Formula | C15H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | methyl 2,2-diphenylethenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 425.4ºC at 760mmHg |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.33500 |
| Flash Point | 211.1ºC |
| Exact Mass | 274.06600 |
| PSA | 51.75000 |
| LogP | 4.13280 |
| Vapour Pressure | 4.76E-07mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | YYLPEJRAPGSFLH-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C=C(c1ccccc1)c1ccccc1 |
|
~%
Ethenesulfonica... CAS#:16003-64-8 |
| Literature: Bordwell,F.G. et al. Journal of Organic Chemistry, 1968 , vol. 33, # 5 p. 2030 - 2035 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2-Diphenyl-aethylen-sulfonsaeure-methylester |
| Ethenesulfonicacid,2,2-diphenyl-,methyl ester |