[5-oxo-4-(3-oxobutyl)-1,2-diphenylpyrazol-3-yl] 3,4,5-trimethoxybenzoate structure
|
Common Name | [5-oxo-4-(3-oxobutyl)-1,2-diphenylpyrazol-3-yl] 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 16006-75-0 | Molecular Weight | 516.54200 | |
| Density | 1.32g/cm3 | Boiling Point | 609.5ºC at 760 mmHg | |
| Molecular Formula | C29H28N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.4ºC | |
| Name | [5-oxo-4-(3-oxobutyl)-1,2-diphenylpyrazol-3-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 609.5ºC at 760 mmHg |
| Molecular Formula | C29H28N2O7 |
| Molecular Weight | 516.54200 |
| Flash Point | 322.4ºC |
| Exact Mass | 516.19000 |
| PSA | 97.99000 |
| LogP | 4.39480 |
| Vapour Pressure | 8.47E-15mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | NPACHMXGQKWFIO-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)Oc2c(CCC(C)=O)c(=O)n(-c3ccccc3)n2-c2ccccc2)cc(OC)c1OC |
| 3,4,5-trimethoxy-benzoic acid 5-oxo-4-(3-oxo-butyl)-1,2-diphenyl-2,5-dihydro-1H-pyrazol-3-yl ester |
| 5-oxo-4-(3-oxobutyl)-1,2-diphenyl-2,5-dihydro-1H-pyrazol-3-yl 3,4,5-trimethoxybenzoate |
| Benzoic acid,3,4,5-trimethoxy-,ester with 1,2-diphenyl-3-hydroxy-4-(3-oxobutyl)-3-pyrazolin-5-one |