Gemopatrilat structure
|
Common Name | Gemopatrilat | ||
|---|---|---|---|---|
| CAS Number | 160135-92-2 | Molecular Weight | 378.48600 | |
| Density | 1.25g/cm3 | Boiling Point | 649.6ºC at 760 mmHg | |
| Molecular Formula | C19H26N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.6ºC | |
Use of GemopatrilatA potent, orally available, dual ACE-neutral endopeptidase (vasopeptidase) inhibitor with IC50 of 12 and 63 nM, respectively. |
| Name | 2-[(6S)-2,2-dimethyl-7-oxo-6-[(3-phenyl-2-sulfanylpropanoyl)amino]azepan-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 649.6ºC at 760 mmHg |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.48600 |
| Flash Point | 346.6ºC |
| Exact Mass | 378.16100 |
| PSA | 129.00000 |
| LogP | 2.66620 |
| Vapour Pressure | 9.28E-18mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | YRSVDSQRGBYVIY-GJZGRUSLSA-N |
| SMILES | CC1(C)CCCC(NC(=O)C(S)Cc2ccccc2)C(=O)N1CC(=O)O |
| Gemopatrilat (USAN/INN) |
| [S-(R*,R*)]-Hexahydro-6-[2-(mercapto-1-oxo-3-phenylpropyl)amino]-2,2-dimethyl-7-oxo-1H-azepine-1-acetic acid |
| UNII-MU9089C77W |
| Gemopatrilat [USAN] |
| [14C]-Gemopatrilat |
| gemopatrilat |
| hexahydro-6-[(2-mercapto-1-oxo-3-phenylpropyl)amino]-2,2-dimethyl-7-oxo-1H-azepine-1-acetic acid |