1-(4-Chloro-benzenesulfonyl)-piperazine structure
|
Common Name | 1-(4-Chloro-benzenesulfonyl)-piperazine | ||
|---|---|---|---|---|
| CAS Number | 16017-53-1 | Molecular Weight | 260.74000 | |
| Density | 1.352g/cm3 | Boiling Point | 401.7ºC at 760 mmHg | |
| Molecular Formula | C10H13ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | 1-(4-Chloro-benzenesulfonyl)-piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 401.7ºC at 760 mmHg |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.74000 |
| Flash Point | 196.7ºC |
| Exact Mass | 260.03900 |
| PSA | 57.79000 |
| LogP | 2.28140 |
| Vapour Pressure | 1.16E-06mmHg at 25°C |
| InChIKey | CKVKEBVACPUEIB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCNCC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2935009090 |
|
~%
1-(4-Chloro-ben... CAS#:16017-53-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 54, # 8 p. 3086 - 3090 |
|
~%
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 69, # 9 p. 3166 - 3172 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| MFCD00973893 |
| 1-(4-chlorophenyl)sulfonylpiperazine |