(2S)-4-carbamoyl-2-[(2,4-dinitrophenyl)amino]butanoic acid structure
|
Common Name | (2S)-4-carbamoyl-2-[(2,4-dinitrophenyl)amino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1602-41-1 | Molecular Weight | 312.23600 | |
| Density | 1.606g/cm3 | Boiling Point | 703.7ºC at 760 mmHg | |
| Molecular Formula | C11H12N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 379.4ºC | |
| Name | n-2,4-dnp-l-glutamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.606g/cm3 |
|---|---|
| Boiling Point | 703.7ºC at 760 mmHg |
| Molecular Formula | C11H12N4O7 |
| Molecular Weight | 312.23600 |
| Flash Point | 379.4ºC |
| Exact Mass | 312.07100 |
| PSA | 184.06000 |
| LogP | 2.45330 |
| Vapour Pressure | 8.71E-21mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | OLIFDVJRECUYJH-QMMMGPOBSA-N |
| SMILES | NC(=O)CCC(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~%
(2S)-4-carbamoy... CAS#:1602-41-1 |
| Literature: Rao; Sober Journal of the American Chemical Society, 1954 , vol. 76, p. 1328,1330 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n-(2,4-dinitrophenyl)-l-glutamine |
| 2,4-Dinitrophenyl-L-glutamine |
| N-2-4-dnp-L-glutamine crystalline |
| N2-(2,4-dinitro-phenyl)-L-glutamine |
| N-(2,4-Dinitro-phenyl)-glutamin |
| N-(2,4-Dinitro-phenyl)-L-glutaminsaeure-5-amid |
| DNP-L-GLUTAMINE |
| DNP-L-Glutamine 2,4-Dinitrophenyl-L-glutamine |