Nα-(2,4-Dinitrophenyl)-L-arginine structure
|
Common Name | Nα-(2,4-Dinitrophenyl)-L-arginine | ||
|---|---|---|---|---|
| CAS Number | 1602-42-2 | Molecular Weight | 340.29200 | |
| Density | 1.65g/cm3 | Boiling Point | 669.2ºC at 760mmHg | |
| Molecular Formula | C12H16N6O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 358.5ºC | |
Use of Nα-(2,4-Dinitrophenyl)-L-arginineNα-(2,4-Dinitrophenyl)-L-arginine is an arginine derivative[1]. |
| Name | nalpha-(2,4-dinitrophenyl)-l-arginine |
|---|---|
| Synonym | More Synonyms |
| Description | Nα-(2,4-Dinitrophenyl)-L-arginine is an arginine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 669.2ºC at 760mmHg |
| Molecular Formula | C12H16N6O6 |
| Molecular Weight | 340.29200 |
| Flash Point | 358.5ºC |
| Exact Mass | 340.11300 |
| PSA | 202.87000 |
| LogP | 2.94170 |
| Vapour Pressure | 8.02E-19mmHg at 25°C |
| Index of Refraction | -34 ° (C=0.5, AcOH) |
| InChIKey | GZJXZYUXRVBOAH-VIFPVBQESA-N |
| SMILES | NC(N)=NCCCC(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| Storage condition | −20°C |
| RIDADR | 1325 |
|---|---|
| WGK Germany | 3 |
| Packaging Group | II |
| HS Code | 2925290090 |
|
~%
Nα-(2,4-Dinitro... CAS#:1602-42-2 |
| Literature: Porter; Sanger Biochemical Journal, 1948 , vol. 42, p. 287,288 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-2,4-DNP-L-ARGININE |
| Nα-Dnp-L-arginine |
| Nα-(2,4-Dinitrophenyl)-L-arginine |
| Dnp-Arg-OH |
| dnp-l-arginine |
| Nalpha-(2,4-Dinitrophenyl)-L-arginine |
| N-DNP-L-arginine |
| N-2-4-dnp-L-arginine crystalline |
| NALPHA-DNP-L-ARGININE |
| DNP-L-arginine |
| N-(2,4-Dinitrophenyl)-L-arginine |
| Nalpha-Dnp-L-arginineDnp-Arg-OH |
| 2,4-dinitrophenyl-L-arginine |