Pyrazine, 2-chloro-,1-oxide structure
|
Common Name | Pyrazine, 2-chloro-,1-oxide | ||
|---|---|---|---|---|
| CAS Number | 16025-16-4 | Molecular Weight | 130.53200 | |
| Density | 1.44g/cm3 | Boiling Point | 346.2ºC at 760 mmHg | |
| Molecular Formula | C4H3ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
| Name | 2-chloro-1-oxidopyrazin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 346.2ºC at 760 mmHg |
| Molecular Formula | C4H3ClN2O |
| Molecular Weight | 130.53200 |
| Flash Point | 163.2ºC |
| Exact Mass | 129.99300 |
| PSA | 38.35000 |
| LogP | 1.16350 |
| Vapour Pressure | 0.000117mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | WMFVTBWTDDQNRO-UHFFFAOYSA-N |
| SMILES | [O-][n+]1ccncc1Cl |
| HS Code | 2933990090 |
|---|
|
~%
Pyrazine, 2-chl... CAS#:16025-16-4 |
| Literature: Cmoch, Piotr Magnetic Resonance in Chemistry, 2003 , vol. 41, # 9 p. 693 - 698 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloropyrazin-1-oxid |
| 2-Chlor-pyrazin-1-N-oxid |
| WMFVTBWTDDQNRO-UHFFFAOYSA |
| InChI=1/C4H3ClN2O/c5-4-3-6-1-2-7(4)8/h1-3H |
| 2-chlor-pyrazin-1-oxid |
| 2-chloropyrazine N-oxide |
| 2-chloropyrazine 1-oxide |