2,6-dinitroanthraquinone structure
|
Common Name | 2,6-dinitroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 1604-40-6 | Molecular Weight | 298.20700 | |
| Density | 1.631g/cm3 | Boiling Point | 563.4ºC at 760mmHg | |
| Molecular Formula | C14H6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294ºC | |
| Name | 2,6-dinitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.631g/cm3 |
|---|---|
| Boiling Point | 563.4ºC at 760mmHg |
| Molecular Formula | C14H6N2O6 |
| Molecular Weight | 298.20700 |
| Flash Point | 294ºC |
| Exact Mass | 298.02300 |
| PSA | 125.78000 |
| LogP | 3.32480 |
| Vapour Pressure | 1.02E-12mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | OPXXCGAYBFDPHY-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)c2ccc([N+](=O)[O-])cc21 |
| HS Code | 2914700090 |
|---|
|
~%
2,6-dinitroanth... CAS#:1604-40-6 |
| Literature: Hoechster Farbwerke Patent: DE167699 ; |
|
~%
Detail
|
| Literature: Battegay; Claudin Bl. Soc. ind. Mulh., vol. 86, p. 629 Chem. Zentralbl., 1921 , vol. 92, # III p. 107 |
|
~%
2,6-dinitroanth... CAS#:1604-40-6
Detail
|
| Literature: Hoechster Farbw. Patent: DE167699 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,6-dinitro-9,10-anthracenedione |
| 2,6-Dinitroanthraquinone |
| 2,6-Dinitroanthrachinon |
| 9,10-Anthracenedione,2,6-dinitro |
| 2,6-dinitro-9,10-anthraquinone |
| EINECS 216-511-9 |