1,8-DINITROANTHRAQUINONE structure
|
Common Name | 1,8-DINITROANTHRAQUINONE | ||
|---|---|---|---|---|
| CAS Number | 129-39-5 | Molecular Weight | 298.20700 | |
| Density | 1.631 g/cm3 | Boiling Point | 563.4ºC at 760 mmHg | |
| Molecular Formula | C14H6N2O6 | Melting Point | 318-322ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 294ºC | |
| Name | 1,8-dinitroanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.631 g/cm3 |
|---|---|
| Boiling Point | 563.4ºC at 760 mmHg |
| Melting Point | 318-322ºC(lit.) |
| Molecular Formula | C14H6N2O6 |
| Molecular Weight | 298.20700 |
| Flash Point | 294ºC |
| Exact Mass | 298.02300 |
| PSA | 125.78000 |
| LogP | 3.32480 |
| Vapour Pressure | 1.02E-12mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | MBIJFIUDKPXMAV-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)c2c1cccc2[N+](=O)[O-] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 1,8-Dinitro-9,10-anthracenedione |
| 1,8-dinitro-10-anthracenedione |
| 1,8-Dinitro-anthrachinon |
| 1,8-Dinitro-9,10-anthraquinone |
| 1,8-dinitro-anthraquinone |
| 1,8-dinitroanthracene-9,10-dione |
| EINECS 204-943-0 |
| 1,8-DINITRO ANTHRAQUINONE MIN |
| 10-Anthracenedione,1,8-dinitro-9 |
| MFCD00604817 |