2,9-Dimethylquinacridone structure
|
Common Name | 2,9-Dimethylquinacridone | ||
|---|---|---|---|---|
| CAS Number | 16043-40-6 | Molecular Weight | 340.375 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 601.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H16N2O2 | Melting Point | 440ºC | |
| MSDS | N/A | Flash Point | 221.4±31.7 °C | |
| Name | 3,10-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 601.6±55.0 °C at 760 mmHg |
| Melting Point | 440ºC |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.375 |
| Flash Point | 221.4±31.7 °C |
| Exact Mass | 340.121185 |
| PSA | 65.72000 |
| LogP | 3.45 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | SMNAVTCHDQBEEJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(=O)c3cc4[nH]c5cc(C)ccc5c(=O)c4cc3[nH]c2c1 |
| HS Code | 3204170000 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,9-Dimethylquinacridone |
| 2,9-Dimethylquinolino[2,3-b]acridine-7,14(5H,12H)-dione |
| 3,10-dimethylquinacridone |
| T G6 E6 C666 BM FQ MM QVJ I1 T1 |
| 5,12-Dihydro-2,9-dimethylquino[2,3-b]acridine-7,14-dione |
| 2,9-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| 3,10-Dimethyl-chinacridon |
| Quino[2,3-b]acridine-7,14-dione, 5,12-dihydro-2,9-dimethyl- |