antirhine structure
|
Common Name | antirhine | ||
|---|---|---|---|---|
| CAS Number | 16049-28-8 | Molecular Weight | 296.407 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 488.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C19H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.1±27.3 °C | |
| Name | (2R)-2-[(2S,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]but-3-en-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.2±40.0 °C at 760 mmHg |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.407 |
| Flash Point | 249.1±27.3 °C |
| Exact Mass | 296.188873 |
| PSA | 39.26000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | RYMNVEAAYOFGCI-DEYYWGMASA-N |
| SMILES | C=CC(CO)C1CCN2CCc3c([nH]c4ccccc34)C2C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Indolo[2,3-a]quinolizine-2-ethanol, β-ethenyl-1,2,3,4,6,7,12,12b-octahydro-, (βR,2S,12bS)- |
| (2R)-2-[(2S,12bS)-1,2,3,4,6,7,12,12b-Octahydroindolo[2,3-a]quinolizin-2-yl]-3-buten-1-ol |