2-Naphthalenecarboxylic acid, 4-hydroxy-8-Methoxy
2-Naphthalenecarboxylic acid, 4-hydroxy-8-Methoxy structure
|
Common Name | 2-Naphthalenecarboxylic acid, 4-hydroxy-8-Methoxy | ||
|---|---|---|---|---|
| CAS Number | 16059-75-9 | Molecular Weight | 218.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10O4 |
|---|---|
| Molecular Weight | 218.20500 |
| Exact Mass | 218.05800 |
| PSA | 66.76000 |
| LogP | 2.25220 |
| Vapour Pressure | 1.21E-08mmHg at 25°C |
| InChIKey | XWBRXUQOEQJGTJ-UHFFFAOYSA-N |
| SMILES | COc1cccc2c(O)cc(C(=O)O)cc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:107775-36-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Naphthalenecarboxylic acid,4-hydroxy-8-methoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid? |
| A: LogP of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid is 2.25220. |
| Q: What is the InChIKey of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid? |
| A: InChIKey of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid is XWBRXUQOEQJGTJ-UHFFFAOYSA-N. |
| Q: What are the downstream products of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid? |
| A: Related downstream products(CAS) of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid: 107775-36-0. |
| Q: What is the CAS number of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid? |
| A: CAS number of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid is 16059-75-9. |
| Q: What is the polar surface area (PSA) of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid? |
| A: Polar surface area (PSA) of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid is 66.76000. |
| Q: What English synonyms does 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid have? |
| A: English synonyms of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid: 2-Naphthalenecarboxylic acid,4-hydroxy-8-methoxy. |
| Q: What is the English name of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid? |
| A: The English name of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid is 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid. |
| Q: What is the Chinese name of 16059-75-9? |
| A: Chinese name of 16059-75-9 is 16059-75-9. |
| Q: What is the molecular formula of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid? |
| A: Molecular formula of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid is C12H10O4. |
| Q: What is the SMILES notation of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid? |
| A: SMILES notation of 4-hydroxy-8-methoxynaphthalene-2-carboxylic acid is COc1cccc2c(O)cc(C(=O)O)cc12. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |