[(2S)-3-oxopentan-2-yl] benzoate
Modify Date: 2025-08-24 12:41:56
![[(2S)-3-oxopentan-2-yl] benzoate Structure](https://image.chemsrc.com/caspic/420/160666-92-2.png)
[(2S)-3-oxopentan-2-yl] benzoate structure
|
Common Name | [(2S)-3-oxopentan-2-yl] benzoate | ||
|---|---|---|---|---|
| CAS Number | 160666-92-2 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2S)-3-oxopentan-2-yl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 43.37000 |
| LogP | 2.21100 |
| InChIKey | WENOPEBWFIDEKJ-VIFPVBQESA-N |
| SMILES | CCC(=O)C(C)OC(=O)c1ccccc1 |
| HS Code | 2916310090 |
|---|
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 3-Pentanone,2-(benzoyloxy)-,(2S) |
| (S)-3-oxopentan-2-yl benzoate |
| (2S)-benzoyloxy-3-pentanone |
| (S)-2-benzoyloxypentane-3-one |
| (2S)-2-(benzoyloxy)pentan-3-one |
| (S)-2-benzoyloxypenta-3-one |
| (S)-2-Benzoyloxypentan-3-one |