L-Phenylalanine,N-(1-oxo-2-propen-1-yl)- structure
|
Common Name | L-Phenylalanine,N-(1-oxo-2-propen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 16069-16-2 | Molecular Weight | 219.23700 | |
| Density | 1.189g/cm3 | Boiling Point | 465.8ºC at 760mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.5ºC | |
| Name | 3-phenyl-2-(prop-2-enoylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 465.8ºC at 760mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 235.5ºC |
| Exact Mass | 219.09000 |
| PSA | 66.40000 |
| LogP | 1.37540 |
| Vapour Pressure | 1.78E-09mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | XFHQGYBXSCRMNT-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC(Cc1ccccc1)C(=O)O |
|
~70%
L-Phenylalanine... CAS#:16069-16-2 |
| Literature: Bueno, Maria P.; Cativiela, Carlos A.; Mayoral, Jose A. Journal of Organic Chemistry, 1991 , vol. 56, # 23 p. 6551 - 6555 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-acryloyl-L-phenylalanine |
| N-acryloyl-(S)-phenylalanine |
| N-Acryloyl-L-phenylalanin |