pentaerythritol dinitrate structure
|
Common Name | pentaerythritol dinitrate | ||
|---|---|---|---|---|
| CAS Number | 1607-01-8 | Molecular Weight | 226.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H10N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | pentaerythritol dinitrate |
|---|
| Molecular Formula | C5H10N2O8 |
|---|---|
| Molecular Weight | 226.14100 |
| Exact Mass | 226.04400 |
| PSA | 150.56000 |
| Vapour Pressure | 0.0111mmHg at 25°C |
| InChIKey | LHSHCLPXMPQXCS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCC(CO)(CO)CO[N+](=O)[O-] |
| HS Code | 2920909090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |