Acetamide,N-phenyl-N-4-piperidinyl- structure
|
Common Name | Acetamide,N-phenyl-N-4-piperidinyl- | ||
|---|---|---|---|---|
| CAS Number | 1607-68-7 | Molecular Weight | 218.29500 | |
| Density | 1.093g/cm3 | Boiling Point | 345.6ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | N-phenyl-N-piperidin-4-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 345.6ºC at 760 mmHg |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29500 |
| Flash Point | 162.8ºC |
| Exact Mass | 218.14200 |
| PSA | 32.34000 |
| LogP | 2.12030 |
| Vapour Pressure | 6.07E-05mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | CYTIQZKDSHKYGB-UHFFFAOYSA-N |
| SMILES | CC(=O)N(c1ccccc1)C1CCNCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Phenyl-N-4-Piperidinylacetamide |
| HMS3094C11 |