Dap-NE structure
|
Common Name | Dap-NE | ||
|---|---|---|---|---|
| CAS Number | 160800-82-8 | Molecular Weight | 320.427 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 527.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.0±30.1 °C | |
Use of Dap-NEDap-NE is an intermediate reagent in the synthesis of the ADC toxin Monomethyl auristatin E (HY-15162)[1]. |
| Name | (2R,3R)-N-[(1S,2R)-1-Hydroxy-1-phenyl-2-propanyl]-3-methoxy-2-methyl-3-[(2S)-2-pyrrolidinyl]propanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Dap-NE is an intermediate reagent in the synthesis of the ADC toxin Monomethyl auristatin E (HY-15162)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 527.8±50.0 °C at 760 mmHg |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.427 |
| Flash Point | 273.0±30.1 °C |
| Exact Mass | 320.209991 |
| LogP | 1.06 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | PHUURGQFDDGNRU-UHFFFAOYSA-N |
| SMILES | COC(C1CCCN1)C(C)C(=O)NC(C)C(O)c1ccccc1 |
| 2-Pyrrolidinepropanamide, N-[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]-β-methoxy-α-methyl-, (αR,βR,2S)- |
| (2R,3R)-N-[(1S,2R)-1-Hydroxy-1-phenyl-2-propanyl]-3-methoxy-2-methyl-3-[(2S)-2-pyrrolidinyl]propanamide |