3-Cyclohexylsalicylic acid structure
|
Common Name | 3-Cyclohexylsalicylic acid | ||
|---|---|---|---|---|
| CAS Number | 16094-36-3 | Molecular Weight | 220.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-cyclohexyl-2-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.26400 |
| Exact Mass | 220.11000 |
| PSA | 57.53000 |
| LogP | 3.13810 |
| InChIKey | QRHLHCSHBDVRNB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(C2CCCCC2)c1O |
| HS Code | 2918290000 |
|---|
|
~%
3-Cyclohexylsal... CAS#:16094-36-3 |
| Literature: Burtner; Brown Journal of the American Chemical Society, 1953 , vol. 75, p. 2334,2337 |
|
~%
3-Cyclohexylsal... CAS#:16094-36-3 |
| Literature: Sahyun Labor. Patent: US2730544 , 1952 ; |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3-Cyclohexylsalicylic acid |
| 3-Cyclohexyl-2-hydroxy-benzoesaeure |
| 3-cyclohexyl-2-hydroxy-benzoic acid |
| Benzoic acid,3-cyclohexyl-2-hydroxy |
| 3-cyclohexyl-2-hydroxybenzenecarboxylic acid |