5-(benzyloxy)-2-hydroxybenzoic acid structure
|
Common Name | 5-(benzyloxy)-2-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 16094-44-3 | Molecular Weight | 244.24300 | |
| Density | N/A | Boiling Point | 450.3±35.0°C | |
| Molecular Formula | C14H12O4 | Melting Point | 166°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-5-phenylmethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 450.3±35.0°C |
|---|---|
| Melting Point | 166°C |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24300 |
| Exact Mass | 244.07400 |
| PSA | 66.76000 |
| LogP | 2.66940 |
| InChIKey | PNERJPORNFOLIT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(OCc2ccccc2)ccc1O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(benzyloxy)-2-hydroxybenzoic acid |
| Benzoic acid,2-hydroxy-5-(phenylmethoxy) |