Prometon structure
|
Common Name | Prometon | ||
|---|---|---|---|---|
| CAS Number | 1610-18-0 | Molecular Weight | 225.291 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 282.4±23.0 °C at 760 mmHg | |
| Molecular Formula | C10H19N5O | Melting Point | 118-121℃ | |
| MSDS | Chinese USA | Flash Point | 124.6±22.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | prometon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.4±23.0 °C at 760 mmHg |
| Melting Point | 118-121℃ |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.291 |
| Flash Point | 124.6±22.6 °C |
| Exact Mass | 225.158966 |
| PSA | 71.96000 |
| LogP | 1.33 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | ISEUFVQQFVOBCY-UHFFFAOYSA-N |
| SMILES | COc1nc(NC(C)C)nc(NC(C)C)n1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN2763 |
| RTECS | XY4200000 |
| HS Code | 2933699013 |
| HS Code | 2933699013 |
|---|---|
| Summary | 2933699013 n2,n4-diisopropyl-6-methoxy-1,3,5-triazine-2,4-diamine。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
Identification of prometon, deisopropylprometon, and hydroxyprometon in groundwater by high resolution liquid chromatography/mass spectrometry.
Sci. Total Environ. 497-498 , 459-66, (2014) Prometon, a major soil sterilant, and its main transformation products, deisopropylprometon (N(2)-isopropyl-6-methoxy-1,3,5-triazine-2,4-diamine) and hydroxyprometon (4,6-bis(isopropylamino)-1,3,5-tri... |
|
|
Mutagenicity testing of nine herbicides and pesticides currently used in agriculture.
Environ. Mol. Mutagen. 25(2) , 148-53, (1995) Nine herbicides and pesticides were tested for their mutagenicity using the Drosophila sex-linked recessive lethal mutation assay. These are Ambush, Treflan, Blazer, Roundup, 2,4-D Amine, Crossbow, Ga... |
|
|
[Degradation of Prometon by O3/H2O2].
Huan Jing Ke Xue 33(4) , 1260-6, (2012) The removal efficiency of Prometon degraded by O3/H2O2 advanced oxidation process (AOP) was represented by the pseudo-first-rate order to discuss the effect of n(H2O2)/n(O3), pH, water quality and HCO... |
| 6-methoxy-N2,N4-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| N,N'-Diisopropyl-6-methoxy-1,3,5-triazine-2,4-diamine |
| Gesafram |
| Pramitol |
| Ontrack-we-2 |
| 2-Propanamine, N,N'-(6-methoxy-1,3,5-triazine-2,4(1H,3H)-diylidene)bis- |
| Methoxypropazine |
| Primatol 25e |
| N,N'-diisopropyl-6-methoxy-[1,3,5]triazine-2,4-diamine |
| 6-methoxy-N,N’-bis(1-methylethyl)-1,3,5-triazine-2,4-diamine |
| 6-methoxy-N,N'-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| N2,N4-diisopropyl-6-methoxy-1,3,5-triazine-2,4-diamine |
| Pramitol 5P |
| Prometon |
| 2,4-Bis-(isopropylamino)-6-methoxy-1,3,5-triazine |
| 1,3,5-Triazine-2,4-diamine, 6-methoxy-N,N-bis(1-methylethyl)- |
| Gesafram 50 |
| prometrone |
| Ontrack |
| 6-methoxy-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| 2-methoxy-4,6-bis(isopropylamino)-1,3,5-triazine |
| 2-methoxy-4,6-bis-(isopropylamino)-s-triazine |
| MFCD00047343 |
| EINECS 216-548-0 |
| (2Z,4E)-N,N'-Diisopropyl-6-methoxy-1,3,5-triazine-2,4(1H,3H)-diimine |
| PROMETONE |