FR 901537 structure
|
Common Name | FR 901537 | ||
|---|---|---|---|---|
| CAS Number | 161162-21-6 | Molecular Weight | 507.62300 | |
| Density | 1.45g/cm3 | Boiling Point | 897.3ºC at 760 mmHg | |
| Molecular Formula | C23H29N3O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 496.5ºC | |
Use of FR 901537FR 901537 is a potent and competitive aromatase inhibitor. FR 901537, a novel naphthol derivative, has the potential for breast cancer research[1]. |
| Name | (2R)-2,4-dihydroxy-N-[3-[2-[(6-hydroxy-2-oxo-1H-benzo[f][1,4]benzothiazin-5-yl)sulfanyl]ethylamino]-3-oxopropyl]-3,3-dimethylbutanamide |
|---|
| Description | FR 901537 is a potent and competitive aromatase inhibitor. FR 901537, a novel naphthol derivative, has the potential for breast cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 897.3ºC at 760 mmHg |
| Molecular Formula | C23H29N3O6S2 |
| Molecular Weight | 507.62300 |
| Flash Point | 496.5ºC |
| Exact Mass | 507.15000 |
| PSA | 209.06000 |
| LogP | 3.44930 |
| Vapour Pressure | 1.25E-34mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | HKEFKAJRMICMPZ-NRFANRHFSA-N |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCCSc1c2c(c3ccccc3c1O)NC(=O)CS2 |