2-benzyl-4-(diethylamino)butanoic acid structure
|
Common Name | 2-benzyl-4-(diethylamino)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1613-24-7 | Molecular Weight | 249.34900 | |
| Density | 1.038g/cm3 | Boiling Point | 387.7ºC at 760mmHg | |
| Molecular Formula | C15H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.3ºC | |
| Name | 2-benzyl-4-(diethylamino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 387.7ºC at 760mmHg |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.34900 |
| Flash Point | 188.3ºC |
| Exact Mass | 249.17300 |
| PSA | 40.54000 |
| LogP | 2.66180 |
| Vapour Pressure | 1.05E-06mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | DWXBSCZVMMZLQW-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(Cc1ccccc1)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Dolyspan |
| 4-Diaethylamino-2-benzyl-buttersaeure |
| 2-Benzyl-4-diethylamino-buttersaeure |
| Dolispan |
| Spasmocalm |
| 2-Benzyl-4-diethylaminobutyric acid |
| 2-Benzyl-4-(N,N-diaethylamino)-buttersaeure |