Dichloro(diphenyl)germane structure
|
Common Name | Dichloro(diphenyl)germane | ||
|---|---|---|---|---|
| CAS Number | 1613-66-7 | Molecular Weight | 297.754 | |
| Density | 1.415 g/mL at 25 °C(lit.) | Boiling Point | 315.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H10Cl2Ge | Melting Point | 9°C | |
| MSDS | N/A | Flash Point | 138.9±20.6 °C | |
| Name | Diphenylgermanium Dichloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 315.5±25.0 °C at 760 mmHg |
| Melting Point | 9°C |
| Molecular Formula | C12H10Cl2Ge |
| Molecular Weight | 297.754 |
| Flash Point | 138.9±20.6 °C |
| Exact Mass | 297.937134 |
| LogP | 8.84 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | n20/D 1.5975(lit.) |
| InChIKey | PFPTYRFVUHDUIN-UHFFFAOYSA-N |
| SMILES | Cl[Ge](Cl)(c1ccccc1)c1ccccc1 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Germane, dichlorodiphenyl- |
| Dichloro(diphenyl)germane |
| MFCD00013587 |
| DiphenyldichlorogerMane |
| EINECS 216-562-7 |