4-(3-hydroxyanilino)-4-oxobutanoic acid structure
|
Common Name | 4-(3-hydroxyanilino)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 16141-43-8 | Molecular Weight | 209.19900 | |
| Density | 1.407g/cm3 | Boiling Point | 535.4ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.6ºC | |
| Name | 4-(3-hydroxyanilino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 535.4ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 277.6ºC |
| Exact Mass | 209.06900 |
| PSA | 86.63000 |
| LogP | 1.26850 |
| Vapour Pressure | 2.71E-12mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | TYCMBBJHYNTEAJ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1cccc(O)c1 |
| HS Code | 2924299090 |
|---|
|
~%
4-(3-hydroxyani... CAS#:16141-43-8 |
| Literature: Trujillo-Ferrara; Vazquez, Ivan; Espinosa, Judith; Santillan, Rosa; Farfan, Norberto; Hoepfl, Herbert European Journal of Pharmaceutical Sciences, 2003 , vol. 18, # 5 p. 313 - 322 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms1490n18 |