4-(3-methylanilino)-4-oxobutanoic acid
Modify Date: 2025-08-26 11:25:10
4-(3-methylanilino)-4-oxobutanoic acid structure
|
Common Name | 4-(3-methylanilino)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 62134-48-9 | Molecular Weight | 207.22600 | |
| Density | 1.245g/cm3 | Boiling Point | 453.2ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | 4-(3-methylanilino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 453.2ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 227.9ºC |
| Exact Mass | 207.09000 |
| PSA | 66.40000 |
| LogP | 1.87130 |
| Index of Refraction | 1.59 |
| InChIKey | VRJAEQGSNATVEE-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)CCC(=O)O)c1 |
| HS Code | 2924299090 |
|---|
|
~73%
4-(3-methylanil... CAS#:62134-48-9 |
| Literature: Omuaru, V. O. T. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1998 , vol. 37, # 8 p. 814 - 816 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:3551-75-5| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-m-Tolyl-succinamidsaeure |
| butanoic acid,4-[(3-methylphenyl)amino]-4-oxo |
| N-m-Tolyl-succinamic acid |
| Bernsteinsaeure-mono-m-toluidid |
| 3-[N-(3-methylphenyl)carbamoyl]propanoic acid |
| 4-[(3-methylphenyl)amino]-4-oxobutanoic acid |