2-(p-Methoxyphenyl)-3,3-diphenylacrylonitrile structure
|
Common Name | 2-(p-Methoxyphenyl)-3,3-diphenylacrylonitrile | ||
|---|---|---|---|---|
| CAS Number | 16143-89-8 | Molecular Weight | 311.37600 | |
| Density | 1.126g/cm3 | Boiling Point | 447.5ºC at 760mmHg | |
| Molecular Formula | C22H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9ºC | |
| Name | 2-(4-methoxyphenyl)-3,3-diphenylprop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 447.5ºC at 760mmHg |
| Molecular Formula | C22H17NO |
| Molecular Weight | 311.37600 |
| Flash Point | 186.9ºC |
| Exact Mass | 311.13100 |
| PSA | 33.02000 |
| LogP | 5.17788 |
| Vapour Pressure | 3.35E-08mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | KPCGDUZWYDQIFG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C#N)=C(c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2926909090 |
|---|
|
~18%
2-(p-Methoxyphe... CAS#:16143-89-8
Detail
|
| Literature: Kitamura, Tsugio; Murakami, Mahito; Kobayashi, Shinjiro; Taniguchi, Hiroshi Tetrahedron Letters, 1986 , vol. 27, # 33 p. 3885 - 3888 |
|
~%
2-(p-Methoxyphe... CAS#:16143-89-8 |
| Literature: Buu-Hoi; Lecocq Journal of the Chemical Society, 1947 , p. 641,643 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(p-Methoxyphenyl)-3,3-diphenylacrylonitrile |
| 3.3-Diphenyl-2-(4-methoxy-phenyl)-acrylsaeure-nitril |
| 3,3-Diphenyl-2-(4-methoxyphenyl)-acrylnitril |
| 2-(4-Methoxy-phenyl)-3,3-diphenyl-acrylonitril |
| 2-(4-methoxy-phenyl)-3,3-diphenyl-acrylonitrile |
| ACRYLONITRILE,2-(p-METHOXYPHENYL)-3,3-DIPHENYL |
| 1-cyano-1-(p-methoxyphenyl)-2,2-diphenylethylene |