Boc-d-phe-onp structure
|
Common Name | Boc-d-phe-onp | ||
|---|---|---|---|---|
| CAS Number | 16159-70-9 | Molecular Weight | 386.39800 | |
| Density | 1.24g/cm3 | Boiling Point | 558.4ºC at 760 mmHg | |
| Molecular Formula | C20H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.5ºC | |
| Name | (4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 558.4ºC at 760 mmHg |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.39800 |
| Flash Point | 291.5ºC |
| Exact Mass | 386.14800 |
| PSA | 110.45000 |
| LogP | 4.55030 |
| Vapour Pressure | 1.67E-12mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | QZIWWFMMLBBICG-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-D-Phe-ONp |
| N-tert-butoxycarbonyl D-phenylalanine p-nitrophenyl ester |
| (R)-4-Nitrophenyl 2-((tert-butoxycarbonyl)amino)-3-phenylpropanoate |
| N-Boc-D-phenylalanine p-nitrophenyl ester |
| Boc-D-Phe-p-ONp |
| N-Boc-D-phenylalanine 4-nitrophenyl ester |
| BOC-D-Phe p-nitrophenyl ester |
| AmbotzBAA5570 |
| 4-Nitrophenyl N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-D-Phenylalaninate |
| tert-butoxycarbonyl-D-phenylalanine p-nitrophenyl ester |
| (R)-N-Boc-phenylalanine 4-nitrophenyl ester |
| Boc-D-phenylalanine 4-nitrophenyl ester |